C16H24O2 — CID 91120775
(1R,8S,9S,10R)-2,2,8,10-tetramethyl-3-oxatricyclo[7.3.1.05,10]tridec-6-en-4-one (PubChem CID 91120775) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1R,8S,9S,10R)-2,2,8,10-tetramethyl-3-oxatricyclo[7.3.1.05,10]tridec-6-en-4-one.
| Compound Name | (1R,8S,9S,10R)-2,2,8,10-tetramethyl-3-oxatricyclo[7.3.1.05,10]tridec-6-en-4-one |
|---|---|
| PubChem CID | 91120775 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1R,8S,9S,10R)-2,2,8,10-tetramethyl-3-oxatricyclo[7.3.1.05,10]tridec-6-en-4-one |
| SMILES | C[C@H]1C=CC2C(=O)OC(C)(C)[C@@H]3CC[C@]2(C)[C@H]1C3 |
| InChI | InChI=1S/C16H24O2/c1-10-5-6-12-14(17)18-15(2,3)11-7-8-16(12,4)13(10)9-11/h5-6,10-13H,7-9H2,1-4H3/t10-,11+,12?,13-,16-/m0/s1 |
| InChIKey | SSOFCYBXOIZDQR-RMZBUKKESA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|