C14H15ClN4O2S — CID 91120942
4-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methyl]piperazine-1-carbothioic S-acid (PubChem CID 91120942) has the molecular formula C14H15ClN4O2S and a molecular weight of 338.82 g/mol. Its IUPAC name is 4-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methyl]piperazine-1-carbothioic S-acid.
| Compound Name | 4-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methyl]piperazine-1-carbothioic S-acid |
|---|---|
| PubChem CID | 91120942 |
| Molecular Formula | C14H15ClN4O2S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 4-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methyl]piperazine-1-carbothioic S-acid |
| SMILES | O=C(S)N1CCN(Cc2noc(-c3cccc(Cl)c3)n2)CC1 |
| InChI | InChI=1S/C14H15ClN4O2S/c15-11-3-1-2-10(8-11)13-16-12(17-21-13)9-18-4-6-19(7-5-18)14(20)22/h1-3,8H,4-7,9H2,(H,20,22) |
| InChIKey | BRQVYDCGUBYERU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|