C18H19ClFNO6S — CID 91120957
2-hydroxyethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1-dioxo-3,5,8,9-tetrahydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxylate (PubChem CID 91120957) has the molecular formula C18H19ClFNO6S and a molecular weight of 431.87 g/mol. Its IUPAC name is 2-hydroxyethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1-dioxo-3,5,8,9-tetrahydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxylate.
| Compound Name | 2-hydroxyethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1-dioxo-3,5,8,9-tetrahydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 91120957 |
| Molecular Formula | C18H19ClFNO6S |
| Molecular Weight | 431.87 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 2-hydroxyethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1-dioxo-3,5,8,9-tetrahydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxylate |
| SMILES | CC1=NC2=C(C(c3c(F)cccc3Cl)C1C(=O)OCCO)S(=O)(=O)CCOC2 |
| InChI | InChI=1S/C18H19ClFNO6S/c1-10-14(18(23)27-6-5-22)16(15-11(19)3-2-4-12(15)20)17-13(21-10)9-26-7-8-28(17,24)25/h2-4,14,16,22H,5-9H2,1H3 |
| InChIKey | XEUVNRMUKIIPMN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.87 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |