About 2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole
2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole (PubChem CID 91120998) has the molecular formula C15H12N3O3S-
and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole.
Molecular Properties
| Compound Name | 2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole |
| PubChem CID | 91120998 |
| Molecular Formula | C15H12N3O3S- |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole |
| SMILES | O=C1Nc2ccccc2C1/C=N/c1ccc(NS(=O)[O-])cc1 |
| InChI | InChI=1S/C15H13N3O3S/c19-15-13(12-3-1-2-4-14(12)17-15)9-16-10-5-7-11(8-6-10)18-22(20)21/h1-9,13,18H,(H,17,19)(H,20,21)/p-1/b16-9+ |
| InChIKey | CGKHTZSLTUEODA-CXUHLZMHSA-M |
| XLogP | 2.33 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole?
The IUPAC name of 2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole (CID 91120998) is 2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole.
What is the SMILES notation for 2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole?
The canonical SMILES for 2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole is O=C1Nc2ccccc2C1/C=N/c1ccc(NS(=O)[O-])cc1.
What is the InChIKey of 2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole?
The InChIKey is CGKHTZSLTUEODA-CXUHLZMHSA-M. The full InChI is InChI=1S/C15H13N3O3S/c19-15-13(12-3-1-2-4-14(12)17-15)9-16-10-5-7-11(8-6-10)18-22(20)21/h1-9,13,18H,(H,17,19)(H,20,21)/p-1/b16-9+.
What are the key properties of 2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole?
2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole has a molecular weight of 314.35 g/mol, XLogP of 2.33, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-3-[[4-(sulfinatoamino)phenyl]iminomethyl]-1,3-dihydroindole is sourced from PubChem (CID 91120998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).