C40H38N2S2Si+2 — CID 91121117
4,8-dimethyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium;methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane (PubChem CID 91121117) has the molecular formula C40H38N2S2Si+2 and a molecular weight of 638.98 g/mol. Its IUPAC name is 4,8-dimethyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium;methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane.
| Compound Name | 4,8-dimethyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium;methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane |
|---|---|
| PubChem CID | 91121117 |
| Molecular Formula | C40H38N2S2Si+2 |
| Molecular Weight | 638.98 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | 4,8-dimethyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium;methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane |
| SMILES | Cc1cccc2[n+]1CSc1c-2cccc1[Si](C)(c1ccccc1)c1ccccc1.Cc1cccc2c1SC[n+]1c(C)cccc1-2 |
| InChI | InChI=1S/C26H24NSSi.C14H14NS/c1-20-11-9-17-24-23-16-10-18-25(26(23)28-19-27(20)24)29(2,21-12-5-3-6-13-21)22-14-7-4-8-15-22;1-10-5-3-7-12-13-8-4-6-11(2)15(13)9-16-14(10)12/h3-18H,19H2,1-2H3;3-8H,9H2,1-2H3/q2*+1 |
| InChIKey | OVSKSYCUSWBHFJ-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.98 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|