About 4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide
4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide (PubChem CID 91121253) has the molecular formula C16H21NO4
and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide.
Molecular Properties
| Compound Name | 4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide |
| PubChem CID | 91121253 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide |
| SMILES | NC(=O)c1ccc(CC2(O)CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C16H21NO4/c17-14(18)13-3-1-12(2-4-13)11-15(19)5-7-16(8-6-15)20-9-10-21-16/h1-4,19H,5-11H2,(H2,17,18) |
| InChIKey | JIOBNWWFZDPTHH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide?
The IUPAC name of 4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide (CID 91121253) is 4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide.
What is the SMILES notation for 4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide?
The canonical SMILES for 4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide is NC(=O)c1ccc(CC2(O)CCC3(CC2)OCCO3)cc1.
What is the InChIKey of 4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide?
The InChIKey is JIOBNWWFZDPTHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO4/c17-14(18)13-3-1-12(2-4-13)11-15(19)5-7-16(8-6-15)20-9-10-21-16/h1-4,19H,5-11H2,(H2,17,18).
What are the key properties of 4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide?
4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide has a molecular weight of 291.35 g/mol, XLogP of 1.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(8-hydroxy-1,4-dioxaspiro[4.5]decan-8-yl)methyl]benzamide is sourced from PubChem (CID 91121253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).