About oct-1-enyl 2-oxopropanoate
oct-1-enyl 2-oxopropanoate (PubChem CID 91121588) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is oct-1-enyl 2-oxopropanoate.
Molecular Properties
| Compound Name | oct-1-enyl 2-oxopropanoate |
| PubChem CID | 91121588 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | oct-1-enyl 2-oxopropanoate |
| SMILES | CCCCCCC=COC(=O)C(C)=O |
| InChI | InChI=1S/C11H18O3/c1-3-4-5-6-7-8-9-14-11(13)10(2)12/h8-9H,3-7H2,1-2H3 |
| InChIKey | NBLZRDZGMAJHQI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze oct-1-enyl 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-1-enyl 2-oxopropanoate?
The IUPAC name of oct-1-enyl 2-oxopropanoate (CID 91121588) is oct-1-enyl 2-oxopropanoate.
What is the SMILES notation for oct-1-enyl 2-oxopropanoate?
The canonical SMILES for oct-1-enyl 2-oxopropanoate is CCCCCCC=COC(=O)C(C)=O.
What is the InChIKey of oct-1-enyl 2-oxopropanoate?
The InChIKey is NBLZRDZGMAJHQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-3-4-5-6-7-8-9-14-11(13)10(2)12/h8-9H,3-7H2,1-2H3.
What are the key properties of oct-1-enyl 2-oxopropanoate?
oct-1-enyl 2-oxopropanoate has a molecular weight of 198.26 g/mol, XLogP of 2.60, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oct-1-enyl 2-oxopropanoate is sourced from PubChem (CID 91121588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).