C22H26F2N2O4S — CID 91121957
N-[3-[3-[1-[4-(2,4-difluorophenyl)phenyl]ethyl]-2-oxo-1,3-oxazinan-6-yl]propyl]methanesulfonamide (PubChem CID 91121957) has the molecular formula C22H26F2N2O4S and a molecular weight of 452.52 g/mol. Its IUPAC name is N-[3-[3-[1-[4-(2,4-difluorophenyl)phenyl]ethyl]-2-oxo-1,3-oxazinan-6-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[3-[1-[4-(2,4-difluorophenyl)phenyl]ethyl]-2-oxo-1,3-oxazinan-6-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 91121957 |
| Molecular Formula | C22H26F2N2O4S |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N-[3-[3-[1-[4-(2,4-difluorophenyl)phenyl]ethyl]-2-oxo-1,3-oxazinan-6-yl]propyl]methanesulfonamide |
| SMILES | CC(c1ccc(-c2ccc(F)cc2F)cc1)N1CCC(CCCNS(C)(=O)=O)OC1=O |
| InChI | InChI=1S/C22H26F2N2O4S/c1-15(16-5-7-17(8-6-16)20-10-9-18(23)14-21(20)24)26-13-11-19(30-22(26)27)4-3-12-25-31(2,28)29/h5-10,14-15,19,25H,3-4,11-13H2,1-2H3 |
| InChIKey | APEMUKPBMYIIMY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|