About 2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane
2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane (PubChem CID 91122013) has the molecular formula C22H40
and a molecular weight of 304.56 g/mol. Its IUPAC name is 2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane |
| PubChem CID | 91122013 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | 2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane |
| SMILES | CC1(C)CC2CCC1C2.CCCCCC1(C)CC2CCC1C2 |
| InChI | InChI=1S/C13H24.C9H16/c1-3-4-5-8-13(2)10-11-6-7-12(13)9-11;1-9(2)6-7-3-4-8(9)5-7/h11-12H,3-10H2,1-2H3;7-8H,3-6H2,1-2H3 |
| InChIKey | RSJSODJPNFCXOZ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane?
The IUPAC name of 2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane (CID 91122013) is 2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane.
What is the SMILES notation for 2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane?
The canonical SMILES for 2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane is CC1(C)CC2CCC1C2.CCCCCC1(C)CC2CCC1C2.
What is the InChIKey of 2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane?
The InChIKey is RSJSODJPNFCXOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24.C9H16/c1-3-4-5-8-13(2)10-11-6-7-12(13)9-11;1-9(2)6-7-3-4-8(9)5-7/h11-12H,3-10H2,1-2H3;7-8H,3-6H2,1-2H3.
What are the key properties of 2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane?
2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane has a molecular weight of 304.56 g/mol, XLogP of 7.23, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylbicyclo[2.2.1]heptane;2-methyl-2-pentylbicyclo[2.2.1]heptane is sourced from PubChem (CID 91122013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).