About 5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne
5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne (PubChem CID 91122454) has the molecular formula C14H22S2
and a molecular weight of 254.46 g/mol. Its IUPAC name is 5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne.
Molecular Properties
| Compound Name | 5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne |
| PubChem CID | 91122454 |
| Molecular Formula | C14H22S2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne |
| SMILES | C#CCC(SC)C(C)C#CCCCCSC |
| InChI | InChI=1S/C14H22S2/c1-5-10-14(16-4)13(2)11-8-6-7-9-12-15-3/h1,13-14H,6-7,9-10,12H2,2-4H3 |
| InChIKey | MFCKYUCWHFZWMH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne?
The IUPAC name of 5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne (CID 91122454) is 5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne.
What is the SMILES notation for 5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne?
The canonical SMILES for 5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne is C#CCC(SC)C(C)C#CCCCCSC.
What is the InChIKey of 5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne?
The InChIKey is MFCKYUCWHFZWMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22S2/c1-5-10-14(16-4)13(2)11-8-6-7-9-12-15-3/h1,13-14H,6-7,9-10,12H2,2-4H3.
What are the key properties of 5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne?
5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne has a molecular weight of 254.46 g/mol, XLogP of 3.91, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4,11-bis(methylsulfanyl)undeca-1,6-diyne is sourced from PubChem (CID 91122454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).