About N-pyrrolidin-1-yldeca-2,4-dienamide
N-pyrrolidin-1-yldeca-2,4-dienamide (PubChem CID 91122483) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is N-pyrrolidin-1-yldeca-2,4-dienamide.
Molecular Properties
| Compound Name | N-pyrrolidin-1-yldeca-2,4-dienamide |
| PubChem CID | 91122483 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N-pyrrolidin-1-yldeca-2,4-dienamide |
| SMILES | CCCCCC=CC=CC(=O)NN1CCCC1 |
| InChI | InChI=1S/C14H24N2O/c1-2-3-4-5-6-7-8-11-14(17)15-16-12-9-10-13-16/h6-8,11H,2-5,9-10,12-13H2,1H3,(H,15,17) |
| InChIKey | KYPXLBVTJRZANG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-pyrrolidin-1-yldeca-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrrolidin-1-yldeca-2,4-dienamide?
The IUPAC name of N-pyrrolidin-1-yldeca-2,4-dienamide (CID 91122483) is N-pyrrolidin-1-yldeca-2,4-dienamide.
What is the SMILES notation for N-pyrrolidin-1-yldeca-2,4-dienamide?
The canonical SMILES for N-pyrrolidin-1-yldeca-2,4-dienamide is CCCCCC=CC=CC(=O)NN1CCCC1.
What is the InChIKey of N-pyrrolidin-1-yldeca-2,4-dienamide?
The InChIKey is KYPXLBVTJRZANG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O/c1-2-3-4-5-6-7-8-11-14(17)15-16-12-9-10-13-16/h6-8,11H,2-5,9-10,12-13H2,1H3,(H,15,17).
What are the key properties of N-pyrrolidin-1-yldeca-2,4-dienamide?
N-pyrrolidin-1-yldeca-2,4-dienamide has a molecular weight of 236.36 g/mol, XLogP of 2.81, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrrolidin-1-yldeca-2,4-dienamide is sourced from PubChem (CID 91122483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).