C32H45N7O6 — CID 91122659
N-[1-[3-[(6-amino-5-nitro-2-pyridinyl)amino]propyl]-4-(4-ethylphenyl)pyrrol-3-yl]-2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-3-[(2-methylpropan-2-yl)oxy]propanamide (PubChem CID 91122659) has the molecular formula C32H45N7O6 and a molecular weight of 623.76 g/mol. Its IUPAC name is N-[1-[3-[(6-amino-5-nitro-2-pyridinyl)amino]propyl]-4-(4-ethylphenyl)pyrrol-3-yl]-2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-3-[(2-methylpropan-2-yl)oxy]propanamide.
| Compound Name | N-[1-[3-[(6-amino-5-nitro-2-pyridinyl)amino]propyl]-4-(4-ethylphenyl)pyrrol-3-yl]-2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-3-[(2-methylpropan-2-yl)oxy]propanamide |
|---|---|
| PubChem CID | 91122659 |
| Molecular Formula | C32H45N7O6 |
| Molecular Weight | 623.76 g/mol |
| Exact Mass | 623.34 |
| IUPAC Name | N-[1-[3-[(6-amino-5-nitro-2-pyridinyl)amino]propyl]-4-(4-ethylphenyl)pyrrol-3-yl]-2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-3-[(2-methylpropan-2-yl)oxy]propanamide |
| SMILES | CCc1ccc(-c2cn(CCCNc3ccc([N+](=O)[O-])c(N)n3)cc2NC(=O)C(COC(C)(C)C)N(C=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C32H45N7O6/c1-8-22-10-12-23(13-11-22)24-18-37(17-9-16-34-28-15-14-26(39(42)43)29(33)36-28)19-25(24)35-30(41)27(20-44-31(2,3)4)38(21-40)45-32(5,6)7/h10-15,18-19,21,27H,8-9,16-17,20H2,1-7H3,(H,35,41)(H3,33,34,36) |
| InChIKey | UGPVSBYPSTZLSU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 166.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.76 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|