About (1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate
(1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate (PubChem CID 91123036) has the molecular formula C23H37N5O5S2
and a molecular weight of 527.71 g/mol. Its IUPAC name is (1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate.
Molecular Properties
| Compound Name | (1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate |
| PubChem CID | 91123036 |
| Molecular Formula | C23H37N5O5S2 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate |
| SMILES | Cc1nc(NC(=O)N(C2CCCCC2)C2CCCCC2)sc1S(=O)(=O)OC1CCN(C(N)=O)CC1 |
| InChI | InChI=1S/C23H37N5O5S2/c1-16-20(35(31,32)33-19-12-14-27(15-13-19)21(24)29)34-22(25-16)26-23(30)28(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h17-19H,2-15H2,1H3,(H2,24,29)(H,25,26,30) |
| InChIKey | DBBNOMHLFTYIFO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate?
The IUPAC name of (1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate (CID 91123036) is (1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate.
What is the SMILES notation for (1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate?
The canonical SMILES for (1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate is Cc1nc(NC(=O)N(C2CCCCC2)C2CCCCC2)sc1S(=O)(=O)OC1CCN(C(N)=O)CC1.
What is the InChIKey of (1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate?
The InChIKey is DBBNOMHLFTYIFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H37N5O5S2/c1-16-20(35(31,32)33-19-12-14-27(15-13-19)21(24)29)34-22(25-16)26-23(30)28(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h17-19H,2-15H2,1H3,(H2,24,29)(H,25,26,30).
What are the key properties of (1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate?
(1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate has a molecular weight of 527.71 g/mol, XLogP of 4.20, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carbamoylpiperidin-4-yl) 2-(dicyclohexylcarbamoylamino)-4-methyl-1,3-thiazole-5-sulfonate is sourced from PubChem (CID 91123036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).