About 1-methyltricyclo[8.2.1.02,9]tridec-11-ene
1-methyltricyclo[8.2.1.02,9]tridec-11-ene (PubChem CID 91123416) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is 1-methyltricyclo[8.2.1.02,9]tridec-11-ene.
Molecular Properties
| Compound Name | 1-methyltricyclo[8.2.1.02,9]tridec-11-ene |
| PubChem CID | 91123416 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 1-methyltricyclo[8.2.1.02,9]tridec-11-ene |
| SMILES | CC12C=CC(C1)C1CCCCCCC12 |
| InChI | InChI=1S/C14H22/c1-14-9-8-11(10-14)12-6-4-2-3-5-7-13(12)14/h8-9,11-13H,2-7,10H2,1H3 |
| InChIKey | VDUFKBZOJCNWDT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyltricyclo[8.2.1.02,9]tridec-11-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyltricyclo[8.2.1.02,9]tridec-11-ene?
The IUPAC name of 1-methyltricyclo[8.2.1.02,9]tridec-11-ene (CID 91123416) is 1-methyltricyclo[8.2.1.02,9]tridec-11-ene.
What is the SMILES notation for 1-methyltricyclo[8.2.1.02,9]tridec-11-ene?
The canonical SMILES for 1-methyltricyclo[8.2.1.02,9]tridec-11-ene is CC12C=CC(C1)C1CCCCCCC12.
What is the InChIKey of 1-methyltricyclo[8.2.1.02,9]tridec-11-ene?
The InChIKey is VDUFKBZOJCNWDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22/c1-14-9-8-11(10-14)12-6-4-2-3-5-7-13(12)14/h8-9,11-13H,2-7,10H2,1H3.
What are the key properties of 1-methyltricyclo[8.2.1.02,9]tridec-11-ene?
1-methyltricyclo[8.2.1.02,9]tridec-11-ene has a molecular weight of 190.33 g/mol, XLogP of 4.17, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyltricyclo[8.2.1.02,9]tridec-11-ene is sourced from PubChem (CID 91123416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).