About (Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine
(Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine (PubChem CID 91123661) has the molecular formula C9H13F2N
and a molecular weight of 173.21 g/mol. Its IUPAC name is (Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine.
Molecular Properties
| Compound Name | (Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine |
| PubChem CID | 91123661 |
| Molecular Formula | C9H13F2N |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | (Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine |
| SMILES | C=C(/C=C\C(C)=N\C)C(C)(F)F |
| InChI | InChI=1S/C9H13F2N/c1-7(9(3,10)11)5-6-8(2)12-4/h5-6H,1H2,2-4H3/b6-5-,12-8+ |
| InChIKey | YGBKWTUBJDAYNQ-ZBKAMDABSA-N |
| XLogP | 2.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine?
The IUPAC name of (Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine (CID 91123661) is (Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine.
What is the SMILES notation for (Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine?
The canonical SMILES for (Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine is C=C(/C=C\C(C)=N\C)C(C)(F)F.
What is the InChIKey of (Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine?
The InChIKey is YGBKWTUBJDAYNQ-ZBKAMDABSA-N. The full InChI is InChI=1S/C9H13F2N/c1-7(9(3,10)11)5-6-8(2)12-4/h5-6H,1H2,2-4H3/b6-5-,12-8+.
What are the key properties of (Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine?
(Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine has a molecular weight of 173.21 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6,6-difluoro-N-methyl-5-methylidenehept-3-en-2-imine is sourced from PubChem (CID 91123661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).