C23H25FO4 — CID 91123992
[2-[(10R,13S)-6-fluoro-10,13-dimethyl-3-oxo-4,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 91123992) has the molecular formula C23H25FO4 and a molecular weight of 384.45 g/mol. Its IUPAC name is [2-[(10R,13S)-6-fluoro-10,13-dimethyl-3-oxo-4,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(10R,13S)-6-fluoro-10,13-dimethyl-3-oxo-4,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 91123992 |
| Molecular Formula | C23H25FO4 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | [2-[(10R,13S)-6-fluoro-10,13-dimethyl-3-oxo-4,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)C1=CCC2C3CC(F)=C4CC(=O)C=C[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C23H25FO4/c1-13(25)28-12-21(27)18-5-4-16-15-11-20(24)19-10-14(26)6-8-23(19,3)17(15)7-9-22(16,18)2/h5-8,15-16H,4,9-12H2,1-3H3/t15?,16?,22-,23+/m0/s1 |
| InChIKey | PMAAQFWGSWVBQK-HUGBHDMDSA-N |
| XLogP | 4.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|