About 2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine
2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine (PubChem CID 91124011) has the molecular formula C18H23ClN3O+
and a molecular weight of 332.86 g/mol. Its IUPAC name is 2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine |
| PubChem CID | 91124011 |
| Molecular Formula | C18H23ClN3O+ |
| Molecular Weight | 332.86 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine |
| SMILES | CCn1c(C=CC=C2OCCN2C)[n+](CC)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H23ClN3O/c1-4-21-15-10-9-14(19)13-16(15)22(5-2)17(21)7-6-8-18-20(3)11-12-23-18/h6-10,13H,4-5,11-12H2,1-3H3/q+1 |
| InChIKey | XTUHVRKFPPVMOW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 21.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.86 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine?
The IUPAC name of 2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine (CID 91124011) is 2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine.
What is the SMILES notation for 2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine?
The canonical SMILES for 2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine is CCn1c(C=CC=C2OCCN2C)[n+](CC)c2ccc(Cl)cc21.
What is the InChIKey of 2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine?
The InChIKey is XTUHVRKFPPVMOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23ClN3O/c1-4-21-15-10-9-14(19)13-16(15)22(5-2)17(21)7-6-8-18-20(3)11-12-23-18/h6-10,13H,4-5,11-12H2,1-3H3/q+1.
What are the key properties of 2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine?
2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine has a molecular weight of 332.86 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-methyl-1,3-oxazolidine is sourced from PubChem (CID 91124011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).