About ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate
ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 91124090) has the molecular formula C13H12F3NO3
and a molecular weight of 287.24 g/mol. Its IUPAC name is ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate |
| PubChem CID | 91124090 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=CC(c2ccc(C(F)(F)F)cc2)ON1 |
| InChI | InChI=1S/C13H12F3NO3/c1-2-19-12(18)10-7-11(20-17-10)8-3-5-9(6-4-8)13(14,15)16/h3-7,11,17H,2H2,1H3 |
| InChIKey | XGKYLSAIBSJYJK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate?
The IUPAC name of ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate (CID 91124090) is ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate.
What is the SMILES notation for ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate?
The canonical SMILES for ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate is CCOC(=O)C1=CC(c2ccc(C(F)(F)F)cc2)ON1.
What is the InChIKey of ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate?
The InChIKey is XGKYLSAIBSJYJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3NO3/c1-2-19-12(18)10-7-11(20-17-10)8-3-5-9(6-4-8)13(14,15)16/h3-7,11,17H,2H2,1H3.
What are the key properties of ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate?
ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate has a molecular weight of 287.24 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 91124090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).