C28H29N3O3S — CID 91124355
2-(4-methyl-N-(2-methylphenyl)sulfonylanilino)-N-(quinolin-2-ylmethyl)butanamide (PubChem CID 91124355) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is 2-(4-methyl-N-(2-methylphenyl)sulfonylanilino)-N-(quinolin-2-ylmethyl)butanamide.
| Compound Name | 2-(4-methyl-N-(2-methylphenyl)sulfonylanilino)-N-(quinolin-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 91124355 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 2-(4-methyl-N-(2-methylphenyl)sulfonylanilino)-N-(quinolin-2-ylmethyl)butanamide |
| SMILES | CCC(C(=O)NCc1ccc2ccccc2n1)N(c1ccc(C)cc1)S(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C28H29N3O3S/c1-4-26(28(32)29-19-23-16-15-22-10-6-7-11-25(22)30-23)31(24-17-13-20(2)14-18-24)35(33,34)27-12-8-5-9-21(27)3/h5-18,26H,4,19H2,1-3H3,(H,29,32) |
| InChIKey | QVJNEFMIFPBHFD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |