C19H26O2 — CID 91124538
(8R,9S,10R,13R,14S,17R)-4-hydroxy-13,17-dimethyl-5,8,9,10,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one (PubChem CID 91124538) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (8R,9S,10R,13R,14S,17R)-4-hydroxy-13,17-dimethyl-5,8,9,10,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13R,14S,17R)-4-hydroxy-13,17-dimethyl-5,8,9,10,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91124538 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (8R,9S,10R,13R,14S,17R)-4-hydroxy-13,17-dimethyl-5,8,9,10,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1CC[C@H]2[C@@H]3C=CC4C(O)C(=O)C=C[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C19H26O2/c1-11-3-7-16-14-4-5-15-12(6-8-17(20)18(15)21)13(14)9-10-19(11,16)2/h4-6,8,11-16,18,21H,3,7,9-10H2,1-2H3/t11-,12-,13-,14-,15?,16+,18?,19-/m1/s1 |
| InChIKey | XOKNQJWDUCDCAY-MGZNEFDHSA-N |
| XLogP | 3.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|