C25H29F3N4O2 — CID 91124904
N'-[1-(4-hydroxypiperidine-1-carbonyl)-5-[4-(trifluoromethyl)phenyl]piperidin-3-yl]benzenecarboximidamide (PubChem CID 91124904) has the molecular formula C25H29F3N4O2 and a molecular weight of 474.53 g/mol. Its IUPAC name is N'-[1-(4-hydroxypiperidine-1-carbonyl)-5-[4-(trifluoromethyl)phenyl]piperidin-3-yl]benzenecarboximidamide.
| Compound Name | N'-[1-(4-hydroxypiperidine-1-carbonyl)-5-[4-(trifluoromethyl)phenyl]piperidin-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 91124904 |
| Molecular Formula | C25H29F3N4O2 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | N'-[1-(4-hydroxypiperidine-1-carbonyl)-5-[4-(trifluoromethyl)phenyl]piperidin-3-yl]benzenecarboximidamide |
| SMILES | N/C(=N\C1CC(c2ccc(C(F)(F)F)cc2)CN(C(=O)N2CCC(O)CC2)C1)c1ccccc1 |
| InChI | InChI=1S/C25H29F3N4O2/c26-25(27,28)20-8-6-17(7-9-20)19-14-21(30-23(29)18-4-2-1-3-5-18)16-32(15-19)24(34)31-12-10-22(33)11-13-31/h1-9,19,21-22,33H,10-16H2,(H2,29,30) |
| InChIKey | SNHOSRCBSVNIPC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|