C8H16N2O5S3 — CID 91124985
4-hydroxy-6-(methylamino)-3,3-dioxo-4,5,6,7-tetrahydro-1,3-dithionine-9-sulfonamide (PubChem CID 91124985) has the molecular formula C8H16N2O5S3 and a molecular weight of 316.43 g/mol. Its IUPAC name is 4-hydroxy-6-(methylamino)-3,3-dioxo-4,5,6,7-tetrahydro-1,3-dithionine-9-sulfonamide.
| Compound Name | 4-hydroxy-6-(methylamino)-3,3-dioxo-4,5,6,7-tetrahydro-1,3-dithionine-9-sulfonamide |
|---|---|
| PubChem CID | 91124985 |
| Molecular Formula | C8H16N2O5S3 |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 4-hydroxy-6-(methylamino)-3,3-dioxo-4,5,6,7-tetrahydro-1,3-dithionine-9-sulfonamide |
| SMILES | CNC1CC=C(S(N)(=O)=O)SCS(=O)(=O)C(O)C1 |
| InChI | InChI=1S/C8H16N2O5S3/c1-10-6-2-3-8(18(9,14)15)16-5-17(12,13)7(11)4-6/h3,6-7,10-11H,2,4-5H2,1H3,(H2,9,14,15) |
| InChIKey | XLSGCPNSPLCQBF-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |