About 1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide
1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide (PubChem CID 91126069) has the molecular formula C13H17NO2S
and a molecular weight of 251.35 g/mol. Its IUPAC name is 1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide |
| PubChem CID | 91126069 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide |
| SMILES | CC(=O)N(O)C(C)C.c1ccc2sccc2c1 |
| InChI | InChI=1S/C8H6S.C5H11NO2/c1-2-4-8-7(3-1)5-6-9-8;1-4(2)6(8)5(3)7/h1-6H;4,8H,1-3H3 |
| InChIKey | WAVFHAJAXRQDMU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide?
The IUPAC name of 1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide (CID 91126069) is 1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide.
What is the SMILES notation for 1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide?
The canonical SMILES for 1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide is CC(=O)N(O)C(C)C.c1ccc2sccc2c1.
What is the InChIKey of 1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide?
The InChIKey is WAVFHAJAXRQDMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S.C5H11NO2/c1-2-4-8-7(3-1)5-6-9-8;1-4(2)6(8)5(3)7/h1-6H;4,8H,1-3H3.
What are the key properties of 1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide?
1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide has a molecular weight of 251.35 g/mol, XLogP of 3.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene;N-hydroxy-N-propan-2-ylacetamide is sourced from PubChem (CID 91126069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).