About 8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione
8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione (PubChem CID 91126174) has the molecular formula C8H6N6O2
and a molecular weight of 218.18 g/mol. Its IUPAC name is 8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione |
| PubChem CID | 91126174 |
| Molecular Formula | C8H6N6O2 |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(-c3cn[nH]c3)nc2[nH]1 |
| InChI | InChI=1S/C8H6N6O2/c15-7-4-6(13-8(16)14-7)12-5(11-4)3-1-9-10-2-3/h1-2H,(H,9,10)(H3,11,12,13,14,15,16) |
| InChIKey | YYBPLJHBILRAON-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 123.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione?
The IUPAC name of 8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione (CID 91126174) is 8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione.
What is the SMILES notation for 8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione?
The canonical SMILES for 8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione is O=c1[nH]c(=O)c2[nH]c(-c3cn[nH]c3)nc2[nH]1.
What is the InChIKey of 8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione?
The InChIKey is YYBPLJHBILRAON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N6O2/c15-7-4-6(13-8(16)14-7)12-5(11-4)3-1-9-10-2-3/h1-2H,(H,9,10)(H3,11,12,13,14,15,16).
What are the key properties of 8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione?
8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione has a molecular weight of 218.18 g/mol, XLogP of -0.67, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1H-pyrazol-4-yl)-3,7-dihydropurine-2,6-dione is sourced from PubChem (CID 91126174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).