C11H17N3O5 — CID 91126286
2-(5-amino-8-oxa-2,6-diazabicyclo[5.1.0]octa-3,5-dien-2-yl)-5-(1-hydroxyethyl)oxolane-3,4-diol (PubChem CID 91126286) has the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-(5-amino-8-oxa-2,6-diazabicyclo[5.1.0]octa-3,5-dien-2-yl)-5-(1-hydroxyethyl)oxolane-3,4-diol.
| Compound Name | 2-(5-amino-8-oxa-2,6-diazabicyclo[5.1.0]octa-3,5-dien-2-yl)-5-(1-hydroxyethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 91126286 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-(5-amino-8-oxa-2,6-diazabicyclo[5.1.0]octa-3,5-dien-2-yl)-5-(1-hydroxyethyl)oxolane-3,4-diol |
| SMILES | CC(O)C1OC(N2C=CC(N)=NC3OC32)C(O)C1O |
| InChI | InChI=1S/C11H17N3O5/c1-4(15)8-6(16)7(17)10(18-8)14-3-2-5(12)13-9-11(14)19-9/h2-4,6-11,15-17H,1H3,(H2,12,13) |
| InChIKey | TZPPGCMHTAQYSP-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|