About 1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane
1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane (PubChem CID 91126750) has the molecular formula C20H35N3O
and a molecular weight of 333.52 g/mol. Its IUPAC name is 1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane.
Molecular Properties
| Compound Name | 1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane |
| PubChem CID | 91126750 |
| Molecular Formula | C20H35N3O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | 1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane |
| SMILES | CC.CC.CN(CCN1CCNCC1=O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H23N3O.2C2H6/c1-18(8-9-19-7-6-17-12-16(19)20)15-10-13-4-2-3-5-14(13)11-15;2*1-2/h2-5,15,17H,6-12H2,1H3;2*1-2H3 |
| InChIKey | DXIRLOQJUGIXFU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane?
The IUPAC name of 1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane (CID 91126750) is 1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane.
What is the SMILES notation for 1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane?
The canonical SMILES for 1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane is CC.CC.CN(CCN1CCNCC1=O)C1Cc2ccccc2C1.
What is the InChIKey of 1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane?
The InChIKey is DXIRLOQJUGIXFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O.2C2H6/c1-18(8-9-19-7-6-17-12-16(19)20)15-10-13-4-2-3-5-14(13)11-15;2*1-2/h2-5,15,17H,6-12H2,1H3;2*1-2H3.
What are the key properties of 1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane?
1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane has a molecular weight of 333.52 g/mol, XLogP of 2.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]ethyl]piperazin-2-one;ethane is sourced from PubChem (CID 91126750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).