C18H13NO6 — CID 911271
9-methyl-8-(4-nitrophenyl)-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-7-one (PubChem CID 911271) has the molecular formula C18H13NO6 and a molecular weight of 339.30 g/mol. Its IUPAC name is 9-methyl-8-(4-nitrophenyl)-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-7-one.
| Compound Name | 9-methyl-8-(4-nitrophenyl)-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-7-one |
|---|---|
| PubChem CID | 911271 |
| Molecular Formula | C18H13NO6 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 9-methyl-8-(4-nitrophenyl)-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-7-one |
| SMILES | Cc1oc2c3c(ccc2c(=O)c1-c1ccc([N+](=O)[O-])cc1)OCCO3 |
| InChI | InChI=1S/C18H13NO6/c1-10-15(11-2-4-12(5-3-11)19(21)22)16(20)13-6-7-14-18(17(13)25-10)24-9-8-23-14/h2-7H,8-9H2,1H3 |
| InChIKey | NTNZHMPSASCYOH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 91.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|