About 5-ethyl-3H-pyridin-2-one
5-ethyl-3H-pyridin-2-one (PubChem CID 91127173) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is 5-ethyl-3H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-ethyl-3H-pyridin-2-one |
| PubChem CID | 91127173 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 5-ethyl-3H-pyridin-2-one |
| SMILES | CCC1=CCC(=O)N=C1 |
| InChI | InChI=1S/C7H9NO/c1-2-6-3-4-7(9)8-5-6/h3,5H,2,4H2,1H3 |
| InChIKey | YADUUCMVABFRHA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-3H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3H-pyridin-2-one?
The IUPAC name of 5-ethyl-3H-pyridin-2-one (CID 91127173) is 5-ethyl-3H-pyridin-2-one.
What is the SMILES notation for 5-ethyl-3H-pyridin-2-one?
The canonical SMILES for 5-ethyl-3H-pyridin-2-one is CCC1=CCC(=O)N=C1.
What is the InChIKey of 5-ethyl-3H-pyridin-2-one?
The InChIKey is YADUUCMVABFRHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c1-2-6-3-4-7(9)8-5-6/h3,5H,2,4H2,1H3.
What are the key properties of 5-ethyl-3H-pyridin-2-one?
5-ethyl-3H-pyridin-2-one has a molecular weight of 123.15 g/mol, XLogP of 1.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3H-pyridin-2-one is sourced from PubChem (CID 91127173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).