C22H42N2O3 — CID 91127346
ethyl 7-ethyl-3,5,5,7,8-pentamethyl-4-[2-(methylamino)propanoylamino]non-8-enoate (PubChem CID 91127346) has the molecular formula C22H42N2O3 and a molecular weight of 382.59 g/mol. Its IUPAC name is ethyl 7-ethyl-3,5,5,7,8-pentamethyl-4-[2-(methylamino)propanoylamino]non-8-enoate.
| Compound Name | ethyl 7-ethyl-3,5,5,7,8-pentamethyl-4-[2-(methylamino)propanoylamino]non-8-enoate |
|---|---|
| PubChem CID | 91127346 |
| Molecular Formula | C22H42N2O3 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.32 |
| IUPAC Name | ethyl 7-ethyl-3,5,5,7,8-pentamethyl-4-[2-(methylamino)propanoylamino]non-8-enoate |
| SMILES | C=C(C)C(C)(CC)CC(C)(C)C(NC(=O)C(C)NC)C(C)CC(=O)OCC |
| InChI | InChI=1S/C22H42N2O3/c1-11-22(9,15(3)4)14-21(7,8)19(24-20(26)17(6)23-10)16(5)13-18(25)27-12-2/h16-17,19,23H,3,11-14H2,1-2,4-10H3,(H,24,26) |
| InChIKey | DDIPNWPABKSDEZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|