About 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol
1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol (PubChem CID 91127383) has the molecular formula C13H13ClF3N3O2
and a molecular weight of 335.71 g/mol. Its IUPAC name is 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol |
| PubChem CID | 91127383 |
| Molecular Formula | C13H13ClF3N3O2 |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol |
| SMILES | CCc1c(C)c(O)n(Nc2ccc(C(F)(F)F)c(Cl)n2)c1O |
| InChI | InChI=1S/C13H13ClF3N3O2/c1-3-7-6(2)11(21)20(12(7)22)19-9-5-4-8(10(14)18-9)13(15,16)17/h4-5,21-22H,3H2,1-2H3,(H,18,19) |
| InChIKey | RVZDDBQYXRKBCB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol?
The IUPAC name of 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol (CID 91127383) is 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol.
What is the SMILES notation for 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol?
The canonical SMILES for 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol is CCc1c(C)c(O)n(Nc2ccc(C(F)(F)F)c(Cl)n2)c1O.
What is the InChIKey of 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol?
The InChIKey is RVZDDBQYXRKBCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClF3N3O2/c1-3-7-6(2)11(21)20(12(7)22)19-9-5-4-8(10(14)18-9)13(15,16)17/h4-5,21-22H,3H2,1-2H3,(H,18,19).
What are the key properties of 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol?
1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol has a molecular weight of 335.71 g/mol, XLogP of 3.71, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-ethyl-4-methylpyrrole-2,5-diol is sourced from PubChem (CID 91127383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).