C18H13F2N5 — CID 911279
(8R,8aS)-6-amino-8-(2,4-difluorophenyl)-2,3,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile (PubChem CID 911279) has the molecular formula C18H13F2N5 and a molecular weight of 337.33 g/mol. Its IUPAC name is (8R,8aS)-6-amino-8-(2,4-difluorophenyl)-2,3,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aS)-6-amino-8-(2,4-difluorophenyl)-2,3,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 911279 |
| Molecular Formula | C18H13F2N5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (8R,8aS)-6-amino-8-(2,4-difluorophenyl)-2,3,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@H](c2ccc(F)cc2F)[C@@H]2CNCC=C12 |
| InChI | InChI=1S/C18H13F2N5/c19-10-1-2-12(15(20)5-10)16-14-7-25-4-3-11(14)13(6-21)17(24)18(16,8-22)9-23/h1-3,5,14,16,25H,4,7,24H2/t14-,16-/m1/s1 |
| InChIKey | WDHKJXIIWZJSEN-GDBMZVCRSA-N |
| XLogP | 1.98 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|