About 2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone
2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone (PubChem CID 91128294) has the molecular formula C20H26ClNO
and a molecular weight of 331.89 g/mol. Its IUPAC name is 2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone.
Molecular Properties
| Compound Name | 2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone |
| PubChem CID | 91128294 |
| Molecular Formula | C20H26ClNO |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone |
| SMILES | CC1(C)Cc2cc(Cl)ccc2C(CC(=O)C2CCCCCC2)=N1 |
| InChI | InChI=1S/C20H26ClNO/c1-20(2)13-15-11-16(21)9-10-17(15)18(22-20)12-19(23)14-7-5-3-4-6-8-14/h9-11,14H,3-8,12-13H2,1-2H3 |
| InChIKey | VDRNVSJPCWAFJM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone?
The IUPAC name of 2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone (CID 91128294) is 2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone.
What is the SMILES notation for 2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone?
The canonical SMILES for 2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone is CC1(C)Cc2cc(Cl)ccc2C(CC(=O)C2CCCCCC2)=N1.
What is the InChIKey of 2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone?
The InChIKey is VDRNVSJPCWAFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26ClNO/c1-20(2)13-15-11-16(21)9-10-17(15)18(22-20)12-19(23)14-7-5-3-4-6-8-14/h9-11,14H,3-8,12-13H2,1-2H3.
What are the key properties of 2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone?
2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone has a molecular weight of 331.89 g/mol, XLogP of 5.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-cycloheptylethanone is sourced from PubChem (CID 91128294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).