C20H27N5O — CID 91128733
1-[[(1R,2R)-2-(5-cyano-1H-indol-3-yl)cyclopropyl]methyl]-1-ethyl-3-[2-(ethylamino)ethyl]urea (PubChem CID 91128733) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-[[(1R,2R)-2-(5-cyano-1H-indol-3-yl)cyclopropyl]methyl]-1-ethyl-3-[2-(ethylamino)ethyl]urea.
| Compound Name | 1-[[(1R,2R)-2-(5-cyano-1H-indol-3-yl)cyclopropyl]methyl]-1-ethyl-3-[2-(ethylamino)ethyl]urea |
|---|---|
| PubChem CID | 91128733 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 1-[[(1R,2R)-2-(5-cyano-1H-indol-3-yl)cyclopropyl]methyl]-1-ethyl-3-[2-(ethylamino)ethyl]urea |
| SMILES | CCNCCNC(=O)N(CC)C[C@@H]1C[C@H]1c1c[nH]c2ccc(C#N)cc12 |
| InChI | InChI=1S/C20H27N5O/c1-3-22-7-8-23-20(26)25(4-2)13-15-10-16(15)18-12-24-19-6-5-14(11-21)9-17(18)19/h5-6,9,12,15-16,22,24H,3-4,7-8,10,13H2,1-2H3,(H,23,26)/t15-,16+/m0/s1 |
| InChIKey | JJSHOXVBBQRGEQ-JKSUJKDBSA-N |
| XLogP | 2.78 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|