About N,2,3-trihydroxypropanamide
N,2,3-trihydroxypropanamide (PubChem CID 91129165) has the molecular formula C3H7NO4
and a molecular weight of 121.09 g/mol. Its IUPAC name is N,2,3-trihydroxypropanamide.
Molecular Properties
| Compound Name | N,2,3-trihydroxypropanamide |
| PubChem CID | 91129165 |
| Molecular Formula | C3H7NO4 |
| Molecular Weight | 121.09 g/mol |
| Exact Mass | 121.04 |
| IUPAC Name | N,2,3-trihydroxypropanamide |
| SMILES | O=C(NO)C(O)CO |
| InChI | InChI=1S/C3H7NO4/c5-1-2(6)3(7)4-8/h2,5-6,8H,1H2,(H,4,7) |
| InChIKey | VHUSHGYHIDFBJH-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.09 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,2,3-trihydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2,3-trihydroxypropanamide?
The IUPAC name of N,2,3-trihydroxypropanamide (CID 91129165) is N,2,3-trihydroxypropanamide.
What is the SMILES notation for N,2,3-trihydroxypropanamide?
The canonical SMILES for N,2,3-trihydroxypropanamide is O=C(NO)C(O)CO.
What is the InChIKey of N,2,3-trihydroxypropanamide?
The InChIKey is VHUSHGYHIDFBJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO4/c5-1-2(6)3(7)4-8/h2,5-6,8H,1H2,(H,4,7).
What are the key properties of N,2,3-trihydroxypropanamide?
N,2,3-trihydroxypropanamide has a molecular weight of 121.09 g/mol, XLogP of -2.15, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,2,3-trihydroxypropanamide is sourced from PubChem (CID 91129165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).