About cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one
cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one (PubChem CID 91129263) has the molecular formula C18H39NO
and a molecular weight of 285.52 g/mol. Its IUPAC name is cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one.
Molecular Properties
| Compound Name | cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one |
| PubChem CID | 91129263 |
| Molecular Formula | C18H39NO |
| Molecular Weight | 285.52 g/mol |
| Exact Mass | 285.30 |
| IUPAC Name | cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one |
| SMILES | C1CCCCC1.CC.CC.CCC1CCC(=O)N(C)C1 |
| InChI | InChI=1S/C8H15NO.C6H12.2C2H6/c1-3-7-4-5-8(10)9(2)6-7;1-2-4-6-5-3-1;2*1-2/h7H,3-6H2,1-2H3;1-6H2;2*1-2H3 |
| InChIKey | NXPYQRZEFRUNLI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one?
The IUPAC name of cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one (CID 91129263) is cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one.
What is the SMILES notation for cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one?
The canonical SMILES for cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one is C1CCCCC1.CC.CC.CCC1CCC(=O)N(C)C1.
What is the InChIKey of cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one?
The InChIKey is NXPYQRZEFRUNLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.C6H12.2C2H6/c1-3-7-4-5-8(10)9(2)6-7;1-2-4-6-5-3-1;2*1-2/h7H,3-6H2,1-2H3;1-6H2;2*1-2H3.
What are the key properties of cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one?
cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one has a molecular weight of 285.52 g/mol, XLogP of 5.66, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;ethane;5-ethyl-1-methylpiperidin-2-one is sourced from PubChem (CID 91129263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).