C21H33N3O5 — CID 91129368
[(2S)-1-[[(2S)-4-(butylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamic acid (PubChem CID 91129368) has the molecular formula C21H33N3O5 and a molecular weight of 407.51 g/mol. Its IUPAC name is [(2S)-1-[[(2S)-4-(butylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[[(2S)-4-(butylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 91129368 |
| Molecular Formula | C21H33N3O5 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | [(2S)-1-[[(2S)-4-(butylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamic acid |
| SMILES | CCCCNC(=O)C(O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)O |
| InChI | InChI=1S/C21H33N3O5/c1-4-5-11-22-20(27)18(25)16(13-15-9-7-6-8-10-15)23-19(26)17(12-14(2)3)24-21(28)29/h6-10,14,16-18,24-25H,4-5,11-13H2,1-3H3,(H,22,27)(H,23,26)(H,28,29)/t16-,17-,18?/m0/s1 |
| InChIKey | SATYZVWESUGFDP-UBFHEZILSA-N |
| XLogP | 1.67 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|