C22H27NO — CID 91129636
4-(4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexa-1,5-dien-1-yl)-3,4,4a,6,7,8-hexahydro-2H-quinolin-5-one (PubChem CID 91129636) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is 4-(4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexa-1,5-dien-1-yl)-3,4,4a,6,7,8-hexahydro-2H-quinolin-5-one.
| Compound Name | 4-(4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexa-1,5-dien-1-yl)-3,4,4a,6,7,8-hexahydro-2H-quinolin-5-one |
|---|---|
| PubChem CID | 91129636 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 4-(4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexa-1,5-dien-1-yl)-3,4,4a,6,7,8-hexahydro-2H-quinolin-5-one |
| SMILES | CC1C=C(C2CCN=C3CCCC(=O)C32)C=CC1C1=CCCC=C1 |
| InChI | InChI=1S/C22H27NO/c1-15-14-17(10-11-18(15)16-6-3-2-4-7-16)19-12-13-23-20-8-5-9-21(24)22(19)20/h3,6-7,10-11,14-15,18-19,22H,2,4-5,8-9,12-13H2,1H3 |
| InChIKey | BOZFJFMTRIIWDE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |