C12H9F13O5 — CID 91129881
methyl 2-[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]acetate (PubChem CID 91129881) has the molecular formula C12H9F13O5 and a molecular weight of 480.17 g/mol. Its IUPAC name is methyl 2-[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]acetate.
| Compound Name | methyl 2-[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]acetate |
|---|---|
| PubChem CID | 91129881 |
| Molecular Formula | C12H9F13O5 |
| Molecular Weight | 480.17 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | methyl 2-[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]acetate |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(COCC(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C12H9F13O5/c1-5(13)8(15,16)30-9(17,11(21,22)23)12(24,25)29-7(14,10(18,19)20)4-28-3-6(26)27-2/h1,3-4H2,2H3 |
| InChIKey | AJILFZHCDXAJRO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.17 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |