About spiro[adamantane-2,1'-cyclopropane]
spiro[adamantane-2,1'-cyclopropane] (PubChem CID 91130175) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is spiro[adamantane-2,1'-cyclopropane].
Molecular Properties
| Compound Name | spiro[adamantane-2,1'-cyclopropane] |
| PubChem CID | 91130175 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | spiro[adamantane-2,1'-cyclopropane] |
| SMILES | C1C2CC3CC1CC(C2)C31CC1 |
| InChI | InChI=1S/C12H18/c1-2-12(1)10-4-8-3-9(6-10)7-11(12)5-8/h8-11H,1-7H2 |
| InChIKey | ZYIPFTBWBGOVBV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze spiro[adamantane-2,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[adamantane-2,1'-cyclopropane]?
The IUPAC name of spiro[adamantane-2,1'-cyclopropane] (CID 91130175) is spiro[adamantane-2,1'-cyclopropane].
What is the SMILES notation for spiro[adamantane-2,1'-cyclopropane]?
The canonical SMILES for spiro[adamantane-2,1'-cyclopropane] is C1C2CC3CC1CC(C2)C31CC1.
What is the InChIKey of spiro[adamantane-2,1'-cyclopropane]?
The InChIKey is ZYIPFTBWBGOVBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18/c1-2-12(1)10-4-8-3-9(6-10)7-11(12)5-8/h8-11H,1-7H2.
What are the key properties of spiro[adamantane-2,1'-cyclopropane]?
spiro[adamantane-2,1'-cyclopropane] has a molecular weight of 162.28 g/mol, XLogP of 3.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[adamantane-2,1'-cyclopropane] is sourced from PubChem (CID 91130175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).