C14H17F2NOS — CID 91130307
2-[(3,4-difluorophenyl)sulfanylmethyl]cyclohexane-1-carboxamide (PubChem CID 91130307) has the molecular formula C14H17F2NOS and a molecular weight of 285.36 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)sulfanylmethyl]cyclohexane-1-carboxamide.
| Compound Name | 2-[(3,4-difluorophenyl)sulfanylmethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91130307 |
| Molecular Formula | C14H17F2NOS |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-[(3,4-difluorophenyl)sulfanylmethyl]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCCCC1CSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H17F2NOS/c15-12-6-5-10(7-13(12)16)19-8-9-3-1-2-4-11(9)14(17)18/h5-7,9,11H,1-4,8H2,(H2,17,18) |
| InChIKey | VTDDRXPVRQOGJM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |