About [1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol
[1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol (PubChem CID 91130399) has the molecular formula C14H23N3O
and a molecular weight of 249.36 g/mol. Its IUPAC name is [1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol.
Molecular Properties
| Compound Name | [1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol |
| PubChem CID | 91130399 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | [1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol |
| SMILES | Cc1ccc(N2CC(C)CN(C)C(CO)C2)cn1 |
| InChI | InChI=1S/C14H23N3O/c1-11-7-16(3)14(10-18)9-17(8-11)13-5-4-12(2)15-6-13/h4-6,11,14,18H,7-10H2,1-3H3 |
| InChIKey | OHVKGSOGYCKFIT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol?
The IUPAC name of [1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol (CID 91130399) is [1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol.
What is the SMILES notation for [1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol?
The canonical SMILES for [1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol is Cc1ccc(N2CC(C)CN(C)C(CO)C2)cn1.
What is the InChIKey of [1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol?
The InChIKey is OHVKGSOGYCKFIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O/c1-11-7-16(3)14(10-18)9-17(8-11)13-5-4-12(2)15-6-13/h4-6,11,14,18H,7-10H2,1-3H3.
What are the key properties of [1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol?
[1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol has a molecular weight of 249.36 g/mol, XLogP of 1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,6-dimethyl-4-(6-methyl-3-pyridinyl)-1,4-diazepan-2-yl]methanol is sourced from PubChem (CID 91130399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).