About 2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide
2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide (PubChem CID 91130820) has the molecular formula C11H19N2O5PS
and a molecular weight of 322.32 g/mol. Its IUPAC name is 2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide.
Molecular Properties
| Compound Name | 2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide |
| PubChem CID | 91130820 |
| Molecular Formula | C11H19N2O5PS |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide |
| SMILES | COCCOCCn1c(O)cc(SCC(=O)NP)c1O |
| InChI | InChI=1S/C11H19N2O5PS/c1-17-4-5-18-3-2-13-10(15)6-8(11(13)16)20-7-9(14)12-19/h6,15-16H,2-5,7,19H2,1H3,(H,12,14) |
| InChIKey | YFOPYGXJOQTTTM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide?
The IUPAC name of 2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide (CID 91130820) is 2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide.
What is the SMILES notation for 2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide?
The canonical SMILES for 2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide is COCCOCCn1c(O)cc(SCC(=O)NP)c1O.
What is the InChIKey of 2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide?
The InChIKey is YFOPYGXJOQTTTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N2O5PS/c1-17-4-5-18-3-2-13-10(15)6-8(11(13)16)20-7-9(14)12-19/h6,15-16H,2-5,7,19H2,1H3,(H,12,14).
What are the key properties of 2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide?
2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide has a molecular weight of 322.32 g/mol, XLogP of 0.56, 9 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,5-dihydroxy-1-[2-(2-methoxyethoxy)ethyl]pyrrol-3-yl]sulfanyl-N-phosphanylacetamide is sourced from PubChem (CID 91130820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).