C23H19FN4O2S — CID 91130829
N-ethoxy-3-fluoro-2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]benzamide (PubChem CID 91130829) has the molecular formula C23H19FN4O2S and a molecular weight of 434.50 g/mol. Its IUPAC name is N-ethoxy-3-fluoro-2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]benzamide.
| Compound Name | N-ethoxy-3-fluoro-2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]benzamide |
|---|---|
| PubChem CID | 91130829 |
| Molecular Formula | C23H19FN4O2S |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N-ethoxy-3-fluoro-2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]benzamide |
| SMILES | CCONC(=O)c1cccc(F)c1Sc1ccc2c(C=Cc3ccccn3)n[nH]c2c1 |
| InChI | InChI=1S/C23H19FN4O2S/c1-2-30-28-23(29)18-7-5-8-19(24)22(18)31-16-10-11-17-20(26-27-21(17)14-16)12-9-15-6-3-4-13-25-15/h3-14H,2H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | FVRWQLVTPLDITO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|