C24H23N3 — CID 9113084
(1S)-N-[(4-imidazol-1-ylphenyl)methyl]-1-(4-methylphenyl)-1-phenylmethanamine (PubChem CID 9113084) has the molecular formula C24H23N3 and a molecular weight of 353.47 g/mol. Its IUPAC name is (1S)-N-[(4-imidazol-1-ylphenyl)methyl]-1-(4-methylphenyl)-1-phenylmethanamine.
| Compound Name | (1S)-N-[(4-imidazol-1-ylphenyl)methyl]-1-(4-methylphenyl)-1-phenylmethanamine |
|---|---|
| PubChem CID | 9113084 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (1S)-N-[(4-imidazol-1-ylphenyl)methyl]-1-(4-methylphenyl)-1-phenylmethanamine |
| SMILES | Cc1ccc([C@@H](NCc2ccc(-n3ccnc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23N3/c1-19-7-11-22(12-8-19)24(21-5-3-2-4-6-21)26-17-20-9-13-23(14-10-20)27-16-15-25-18-27/h2-16,18,24,26H,17H2,1H3/t24-/m0/s1 |
| InChIKey | CNKKUALOXYRRLC-DEOSSOPVSA-N |
| XLogP | 5.06 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |