About 2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one
2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one (PubChem CID 91130922) has the molecular formula C14H16BrNO
and a molecular weight of 294.19 g/mol. Its IUPAC name is 2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one |
| PubChem CID | 91130922 |
| Molecular Formula | C14H16BrNO |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CC/C(=N\c2ccc(Br)cc2)C(=O)C1 |
| InChI | InChI=1S/C14H16BrNO/c1-14(2)8-7-12(13(17)9-14)16-11-5-3-10(15)4-6-11/h3-6H,7-9H2,1-2H3/b16-12+ |
| InChIKey | YRINZLDXKKXFSH-FOWTUZBSSA-N |
| XLogP | 4.30 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one?
The IUPAC name of 2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one (CID 91130922) is 2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one.
What is the SMILES notation for 2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one?
The canonical SMILES for 2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one is CC1(C)CC/C(=N\c2ccc(Br)cc2)C(=O)C1.
What is the InChIKey of 2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one?
The InChIKey is YRINZLDXKKXFSH-FOWTUZBSSA-N. The full InChI is InChI=1S/C14H16BrNO/c1-14(2)8-7-12(13(17)9-14)16-11-5-3-10(15)4-6-11/h3-6H,7-9H2,1-2H3/b16-12+.
What are the key properties of 2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one?
2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one has a molecular weight of 294.19 g/mol, XLogP of 4.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)imino-5,5-dimethylcyclohexan-1-one is sourced from PubChem (CID 91130922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).