C28H39FO4Si — CID 91130944
[(1R,3S,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(3-fluorophenyl)cyclopentyl] 3-(4-methoxyphenyl)propanoate (PubChem CID 91130944) has the molecular formula C28H39FO4Si and a molecular weight of 486.70 g/mol. Its IUPAC name is [(1R,3S,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(3-fluorophenyl)cyclopentyl] 3-(4-methoxyphenyl)propanoate.
| Compound Name | [(1R,3S,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(3-fluorophenyl)cyclopentyl] 3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 91130944 |
| Molecular Formula | C28H39FO4Si |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | [(1R,3S,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(3-fluorophenyl)cyclopentyl] 3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc(CCC(=O)O[C@H]2C[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](c3cccc(F)c3)C2)cc1 |
| InChI | InChI=1S/C28H39FO4Si/c1-28(2,3)34(5,6)32-19-22-17-25(18-26(22)21-8-7-9-23(29)16-21)33-27(30)15-12-20-10-13-24(31-4)14-11-20/h7-11,13-14,16,22,25-26H,12,15,17-19H2,1-6H3/t22-,25+,26-/m1/s1 |
| InChIKey | LYVYRADPFBRQCF-ZSQFBXSQSA-N |
| XLogP | 6.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|