About N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane
N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane (PubChem CID 91131004) has the molecular formula C18H27F3N2O
and a molecular weight of 344.42 g/mol. Its IUPAC name is N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane.
Molecular Properties
| Compound Name | N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane |
| PubChem CID | 91131004 |
| Molecular Formula | C18H27F3N2O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane |
| SMILES | C=C(NC1CCN(CCC)CC1)c1ccccc1.COC(F)(F)F |
| InChI | InChI=1S/C16H24N2.C2H3F3O/c1-3-11-18-12-9-16(10-13-18)17-14(2)15-7-5-4-6-8-15;1-6-2(3,4)5/h4-8,16-17H,2-3,9-13H2,1H3;1H3 |
| InChIKey | KSJZNDJREDBKDQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane?
The IUPAC name of N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane (CID 91131004) is N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane.
What is the SMILES notation for N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane?
The canonical SMILES for N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane is C=C(NC1CCN(CCC)CC1)c1ccccc1.COC(F)(F)F.
What is the InChIKey of N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane?
The InChIKey is KSJZNDJREDBKDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2.C2H3F3O/c1-3-11-18-12-9-16(10-13-18)17-14(2)15-7-5-4-6-8-15;1-6-2(3,4)5/h4-8,16-17H,2-3,9-13H2,1H3;1H3.
What are the key properties of N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane?
N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane has a molecular weight of 344.42 g/mol, XLogP of 4.27, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-phenylethenyl)-1-propylpiperidin-4-amine;trifluoro(methoxy)methane is sourced from PubChem (CID 91131004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).