C33H51NO5 — CID 91131217
[[(3R,6aR,6bS,8aS,11S,12aS,14aR,14bS)-11-carbamoyl-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl]-hydroxymethyl] acetate (PubChem CID 91131217) has the molecular formula C33H51NO5 and a molecular weight of 541.77 g/mol. Its IUPAC name is [[(3R,6aR,6bS,8aS,11S,12aS,14aR,14bS)-11-carbamoyl-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl]-hydroxymethyl] acetate.
| Compound Name | [[(3R,6aR,6bS,8aS,11S,12aS,14aR,14bS)-11-carbamoyl-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl]-hydroxymethyl] acetate |
|---|---|
| PubChem CID | 91131217 |
| Molecular Formula | C33H51NO5 |
| Molecular Weight | 541.77 g/mol |
| Exact Mass | 541.38 |
| IUPAC Name | [[(3R,6aR,6bS,8aS,11S,12aS,14aR,14bS)-11-carbamoyl-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl]-hydroxymethyl] acetate |
| SMILES | CC(=O)OC(O)[C@@H]1CC[C@@]2(C)C(CC[C@]3(C)[C@@H]2C(=O)C=C2[C@H]4C[C@@](C)(C(N)=O)CC[C@]4(C)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C33H51NO5/c1-19(35)39-26(37)20-9-11-31(6)24(28(20,2)3)10-12-33(8)25(31)23(36)17-21-22-18-30(5,27(34)38)14-13-29(22,4)15-16-32(21,33)7/h17,20,22,24-26,37H,9-16,18H2,1-8H3,(H2,34,38)/t20-,22+,24?,25+,26?,29+,30-,31-,32+,33+/m0/s1 |
| InChIKey | KDINVXRDBWUVLZ-KSORYBHLSA-N |
| XLogP | 5.95 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.77 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|