About 1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid
1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid (PubChem CID 91131247) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid |
| PubChem CID | 91131247 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid |
| SMILES | C=CC=C(C)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C11H17NO2/c1-3-4-9(2)12-7-5-10(6-8-12)11(13)14/h3-4,10H,1,5-8H2,2H3,(H,13,14) |
| InChIKey | LALUHBAXKFQGQO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid?
The IUPAC name of 1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid (CID 91131247) is 1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid.
What is the SMILES notation for 1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid?
The canonical SMILES for 1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid is C=CC=C(C)N1CCC(C(=O)O)CC1.
What is the InChIKey of 1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid?
The InChIKey is LALUHBAXKFQGQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-3-4-9(2)12-7-5-10(6-8-12)11(13)14/h3-4,10H,1,5-8H2,2H3,(H,13,14).
What are the key properties of 1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid?
1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid has a molecular weight of 195.26 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-penta-2,4-dien-2-ylpiperidine-4-carboxylic acid is sourced from PubChem (CID 91131247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).