C28H50N2O2 — CID 91131267
4-ethenyl-2,2,6,6-tetramethylpiperidine;2-(4-ethenyl-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 2-methylprop-2-enoate (PubChem CID 91131267) has the molecular formula C28H50N2O2 and a molecular weight of 446.72 g/mol. Its IUPAC name is 4-ethenyl-2,2,6,6-tetramethylpiperidine;2-(4-ethenyl-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 2-methylprop-2-enoate.
| Compound Name | 4-ethenyl-2,2,6,6-tetramethylpiperidine;2-(4-ethenyl-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91131267 |
| Molecular Formula | C28H50N2O2 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.39 |
| IUPAC Name | 4-ethenyl-2,2,6,6-tetramethylpiperidine;2-(4-ethenyl-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 2-methylprop-2-enoate |
| SMILES | C=CC1CC(C)(C)N(CCOC(=O)C(=C)C)C(C)(C)C1.C=CC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C17H29NO2.C11H21N/c1-8-14-11-16(4,5)18(17(6,7)12-14)9-10-20-15(19)13(2)3;1-6-9-7-10(2,3)12-11(4,5)8-9/h8,14H,1-2,9-12H2,3-7H3;6,9,12H,1,7-8H2,2-5H3 |
| InChIKey | IWIPMCYXVKNFBA-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|